C20H27N3O4 — CID 174986695
tert-butyl 6-[(3-ethynylphenyl)carbamoylamino]-2-formamidohexanoate (PubChem CID 174986695) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is tert-butyl 6-[(3-ethynylphenyl)carbamoylamino]-2-formamidohexanoate.
| Compound Name | tert-butyl 6-[(3-ethynylphenyl)carbamoylamino]-2-formamidohexanoate |
|---|---|
| PubChem CID | 174986695 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | tert-butyl 6-[(3-ethynylphenyl)carbamoylamino]-2-formamidohexanoate |
| SMILES | C#Cc1cccc(NC(=O)NCCCCC(NC=O)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C20H27N3O4/c1-5-15-9-8-10-16(13-15)23-19(26)21-12-7-6-11-17(22-14-24)18(25)27-20(2,3)4/h1,8-10,13-14,17H,6-7,11-12H2,2-4H3,(H,22,24)(H2,21,23,26) |
| InChIKey | BAAPXMSJRPVPIG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|