C16H22IN3O4 — CID 44520092
methyl 2-acetamido-6-[(3-(125I)iodophenyl)carbamoylamino]hexanoate (PubChem CID 44520092) has the molecular formula C16H22IN3O4 and a molecular weight of 445.27 g/mol. Its IUPAC name is methyl 2-acetamido-6-[(3-(125I)iodophenyl)carbamoylamino]hexanoate.
| Compound Name | methyl 2-acetamido-6-[(3-(125I)iodophenyl)carbamoylamino]hexanoate |
|---|---|
| PubChem CID | 44520092 |
| Molecular Formula | C16H22IN3O4 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | methyl 2-acetamido-6-[(3-(125I)iodophenyl)carbamoylamino]hexanoate |
| SMILES | COC(=O)C(CCCCNC(=O)Nc1cccc([125I])c1)NC(C)=O |
| InChI | InChI=1S/C16H22IN3O4/c1-11(21)19-14(15(22)24-2)8-3-4-9-18-16(23)20-13-7-5-6-12(17)10-13/h5-7,10,14H,3-4,8-9H2,1-2H3,(H,19,21)(H2,18,20,23)/i17-2 |
| InChIKey | ILHFOWUQDIEFKM-QZIRHQCUSA-N |
| XLogP | 2.26 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|