C24H38N6O5 — CID 155357323
ditert-butyl (2S)-2-[[4-(4-azidophenyl)butylamino]carbamoylamino]pentanedioate (PubChem CID 155357323) has the molecular formula C24H38N6O5 and a molecular weight of 490.61 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[4-(4-azidophenyl)butylamino]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[4-(4-azidophenyl)butylamino]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 155357323 |
| Molecular Formula | C24H38N6O5 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | ditert-butyl (2S)-2-[[4-(4-azidophenyl)butylamino]carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)NNCCCCc1ccc(N=[N+]=[N-])cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H38N6O5/c1-23(2,3)34-20(31)15-14-19(21(32)35-24(4,5)6)27-22(33)29-26-16-8-7-9-17-10-12-18(13-11-17)28-30-25/h10-13,19,26H,7-9,14-16H2,1-6H3,(H2,27,29,33)/t19-/m0/s1 |
| InChIKey | GVJSXBKKXZABRB-IBGZPJMESA-N |
| XLogP | 4.59 |
| TPSA | 154.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|