C15H15NO4 — CID 142436740
(1,3-dioxoisoindol-2-yl) 1-methylcyclopentane-1-carboxylate (PubChem CID 142436740) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 1-methylcyclopentane-1-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl) 1-methylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 142436740 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 1-methylcyclopentane-1-carboxylate |
| SMILES | CC1(C(=O)ON2C(=O)c3ccccc3C2=O)CCCC1 |
| InChI | InChI=1S/C15H15NO4/c1-15(8-4-5-9-15)14(19)20-16-12(17)10-6-2-3-7-11(10)13(16)18/h2-3,6-7H,4-5,8-9H2,1H3 |
| InChIKey | DUSWAUAMUMIZLA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|