About (1,3-dioxoisoindol-2-yl) 2-oxabicyclo[2.1.1]hexane-4-carboxylate
(1,3-dioxoisoindol-2-yl) 2-oxabicyclo[2.1.1]hexane-4-carboxylate (PubChem CID 170730481) has the molecular formula C14H11NO5
and a molecular weight of 273.24 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 2-oxabicyclo[2.1.1]hexane-4-carboxylate.
Molecular Properties
| Compound Name | (1,3-dioxoisoindol-2-yl) 2-oxabicyclo[2.1.1]hexane-4-carboxylate |
| PubChem CID | 170730481 |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 2-oxabicyclo[2.1.1]hexane-4-carboxylate |
| SMILES | O=C1c2ccccc2C(=O)N1OC(=O)C12COC(C1)C2 |
| InChI | InChI=1S/C14H11NO5/c16-11-9-3-1-2-4-10(9)12(17)15(11)20-13(18)14-5-8(6-14)19-7-14/h1-4,8H,5-7H2 |
| InChIKey | WQVCTYPAIARRRG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dioxoisoindol-2-yl) 2-oxabicyclo[2.1.1]hexane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dioxoisoindol-2-yl) 2-oxabicyclo[2.1.1]hexane-4-carboxylate?
The IUPAC name of (1,3-dioxoisoindol-2-yl) 2-oxabicyclo[2.1.1]hexane-4-carboxylate (CID 170730481) is (1,3-dioxoisoindol-2-yl) 2-oxabicyclo[2.1.1]hexane-4-carboxylate.
What is the SMILES notation for (1,3-dioxoisoindol-2-yl) 2-oxabicyclo[2.1.1]hexane-4-carboxylate?
The canonical SMILES for (1,3-dioxoisoindol-2-yl) 2-oxabicyclo[2.1.1]hexane-4-carboxylate is O=C1c2ccccc2C(=O)N1OC(=O)C12COC(C1)C2.
What is the InChIKey of (1,3-dioxoisoindol-2-yl) 2-oxabicyclo[2.1.1]hexane-4-carboxylate?
The InChIKey is WQVCTYPAIARRRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO5/c16-11-9-3-1-2-4-10(9)12(17)15(11)20-13(18)14-5-8(6-14)19-7-14/h1-4,8H,5-7H2.
What are the key properties of (1,3-dioxoisoindol-2-yl) 2-oxabicyclo[2.1.1]hexane-4-carboxylate?
(1,3-dioxoisoindol-2-yl) 2-oxabicyclo[2.1.1]hexane-4-carboxylate has a molecular weight of 273.24 g/mol, XLogP of 0.92, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dioxoisoindol-2-yl) 2-oxabicyclo[2.1.1]hexane-4-carboxylate is sourced from PubChem (CID 170730481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).