C17H17NO6 — CID 102587184
2-O-(1,3-dioxoisoindol-2-yl) 1-O-(1-methylcyclohexyl) oxalate (PubChem CID 102587184) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is 2-O-(1,3-dioxoisoindol-2-yl) 1-O-(1-methylcyclohexyl) oxalate.
| Compound Name | 2-O-(1,3-dioxoisoindol-2-yl) 1-O-(1-methylcyclohexyl) oxalate |
|---|---|
| PubChem CID | 102587184 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-O-(1,3-dioxoisoindol-2-yl) 1-O-(1-methylcyclohexyl) oxalate |
| SMILES | CC1(OC(=O)C(=O)ON2C(=O)c3ccccc3C2=O)CCCCC1 |
| InChI | InChI=1S/C17H17NO6/c1-17(9-5-2-6-10-17)23-15(21)16(22)24-18-13(19)11-7-3-4-8-12(11)14(18)20/h3-4,7-8H,2,5-6,9-10H2,1H3 |
| InChIKey | AYWUGCUSQYABFR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|