C14H14N2O3 — CID 21441264
1-(1,3-dioxoisoindol-2-yl)cyclopentane-1-carboxamide (PubChem CID 21441264) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 1-(1,3-dioxoisoindol-2-yl)cyclopentane-1-carboxamide.
| Compound Name | 1-(1,3-dioxoisoindol-2-yl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 21441264 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-(1,3-dioxoisoindol-2-yl)cyclopentane-1-carboxamide |
| SMILES | NC(=O)C1(N2C(=O)c3ccccc3C2=O)CCCC1 |
| InChI | InChI=1S/C14H14N2O3/c15-13(19)14(7-3-4-8-14)16-11(17)9-5-1-2-6-10(9)12(16)18/h1-2,5-6H,3-4,7-8H2,(H2,15,19) |
| InChIKey | KYEFOESGLYKJLH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|