C21H26N2O6 — CID 178202377
1-O-tert-butyl 2-O-(1,3-dioxoisoindol-2-yl) (2R,4S)-4-ethylpiperidine-1,2-dicarboxylate (PubChem CID 178202377) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-(1,3-dioxoisoindol-2-yl) (2R,4S)-4-ethylpiperidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-(1,3-dioxoisoindol-2-yl) (2R,4S)-4-ethylpiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 178202377 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-O-tert-butyl 2-O-(1,3-dioxoisoindol-2-yl) (2R,4S)-4-ethylpiperidine-1,2-dicarboxylate |
| SMILES | CC[C@H]1CCN(C(=O)OC(C)(C)C)[C@@H](C(=O)ON2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C21H26N2O6/c1-5-13-10-11-22(20(27)28-21(2,3)4)16(12-13)19(26)29-23-17(24)14-8-6-7-9-15(14)18(23)25/h6-9,13,16H,5,10-12H2,1-4H3/t13-,16+/m0/s1 |
| InChIKey | AAQNMJOTULANDS-XJKSGUPXSA-N |
| XLogP | 3.17 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|