C30H26N2O6 — CID 178202346
3-O-(1,3-dioxoisoindol-2-yl) 1-O-(9H-fluoren-9-ylmethyl) (2S,3S)-2-methylpiperidine-1,3-dicarboxylate (PubChem CID 178202346) has the molecular formula C30H26N2O6 and a molecular weight of 510.55 g/mol. Its IUPAC name is 3-O-(1,3-dioxoisoindol-2-yl) 1-O-(9H-fluoren-9-ylmethyl) (2S,3S)-2-methylpiperidine-1,3-dicarboxylate.
| Compound Name | 3-O-(1,3-dioxoisoindol-2-yl) 1-O-(9H-fluoren-9-ylmethyl) (2S,3S)-2-methylpiperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 178202346 |
| Molecular Formula | C30H26N2O6 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 3-O-(1,3-dioxoisoindol-2-yl) 1-O-(9H-fluoren-9-ylmethyl) (2S,3S)-2-methylpiperidine-1,3-dicarboxylate |
| SMILES | C[C@H]1[C@@H](C(=O)ON2C(=O)c3ccccc3C2=O)CCCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H26N2O6/c1-18-19(29(35)38-32-27(33)24-13-6-7-14-25(24)28(32)34)15-8-16-31(18)30(36)37-17-26-22-11-4-2-9-20(22)21-10-3-5-12-23(21)26/h2-7,9-14,18-19,26H,8,15-17H2,1H3/t18-,19-/m0/s1 |
| InChIKey | JAMGSIFEPUHXOR-OALUTQOASA-N |
| XLogP | 4.79 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|