C18H20N2O3 — CID 11324408
N-[(2S,4R,5R)-2-(4-aminophenyl)-4-methyl-1,3-dioxan-5-yl]benzamide (PubChem CID 11324408) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-[(2S,4R,5R)-2-(4-aminophenyl)-4-methyl-1,3-dioxan-5-yl]benzamide.
| Compound Name | N-[(2S,4R,5R)-2-(4-aminophenyl)-4-methyl-1,3-dioxan-5-yl]benzamide |
|---|---|
| PubChem CID | 11324408 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-[(2S,4R,5R)-2-(4-aminophenyl)-4-methyl-1,3-dioxan-5-yl]benzamide |
| SMILES | C[C@H]1O[C@@H](c2ccc(N)cc2)OC[C@H]1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O3/c1-12-16(20-17(21)13-5-3-2-4-6-13)11-22-18(23-12)14-7-9-15(19)10-8-14/h2-10,12,16,18H,11,19H2,1H3,(H,20,21)/t12-,16-,18+/m1/s1 |
| InChIKey | CGPFPXGLWRXWDL-NJAPINKUSA-N |
| XLogP | 2.50 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|