C22H29NO3S — CID 24827705
(2S,3R,4S,5R,6R)-2-ethylsulfanyl-6-methyl-3,5-bis(phenylmethoxy)oxan-4-amine (PubChem CID 24827705) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-ethylsulfanyl-6-methyl-3,5-bis(phenylmethoxy)oxan-4-amine.
| Compound Name | (2S,3R,4S,5R,6R)-2-ethylsulfanyl-6-methyl-3,5-bis(phenylmethoxy)oxan-4-amine |
|---|---|
| PubChem CID | 24827705 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-ethylsulfanyl-6-methyl-3,5-bis(phenylmethoxy)oxan-4-amine |
| SMILES | CCS[C@@H]1O[C@H](C)[C@H](OCc2ccccc2)[C@H](N)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H29NO3S/c1-3-27-22-21(25-15-18-12-8-5-9-13-18)19(23)20(16(2)26-22)24-14-17-10-6-4-7-11-17/h4-13,16,19-22H,3,14-15,23H2,1-2H3/t16-,19+,20+,21-,22+/m1/s1 |
| InChIKey | SXOWMWDLLCBVKM-UGTAXJHQSA-N |
| XLogP | 3.98 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |