C22H24O5S — CID 102399450
(1S,4S,6R,7S,8S)-6-ethylsulfanyl-7,8-bis(phenylmethoxy)-2,5-dioxabicyclo[2.2.2]octan-3-one (PubChem CID 102399450) has the molecular formula C22H24O5S and a molecular weight of 400.50 g/mol. Its IUPAC name is (1S,4S,6R,7S,8S)-6-ethylsulfanyl-7,8-bis(phenylmethoxy)-2,5-dioxabicyclo[2.2.2]octan-3-one.
| Compound Name | (1S,4S,6R,7S,8S)-6-ethylsulfanyl-7,8-bis(phenylmethoxy)-2,5-dioxabicyclo[2.2.2]octan-3-one |
|---|---|
| PubChem CID | 102399450 |
| Molecular Formula | C22H24O5S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (1S,4S,6R,7S,8S)-6-ethylsulfanyl-7,8-bis(phenylmethoxy)-2,5-dioxabicyclo[2.2.2]octan-3-one |
| SMILES | CCS[C@H]1O[C@@H]2C(=O)O[C@H]1[C@@H](OCc1ccccc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C22H24O5S/c1-2-28-22-20-18(25-14-16-11-7-4-8-12-16)17(19(27-22)21(23)26-20)24-13-15-9-5-3-6-10-15/h3-12,17-20,22H,2,13-14H2,1H3/t17-,18-,19-,20-,22+/m0/s1 |
| InChIKey | AVVNEGDUQRCLMT-SPNOPHAYSA-N |
| XLogP | 3.56 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |