C23H36O6 — CID 76686162
[3,4,5-trimethyl-6-[2-(2-propoxyethoxy)ethoxy]oxan-2-yl]methyl benzoate (PubChem CID 76686162) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is [3,4,5-trimethyl-6-[2-(2-propoxyethoxy)ethoxy]oxan-2-yl]methyl benzoate.
| Compound Name | [3,4,5-trimethyl-6-[2-(2-propoxyethoxy)ethoxy]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 76686162 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | [3,4,5-trimethyl-6-[2-(2-propoxyethoxy)ethoxy]oxan-2-yl]methyl benzoate |
| SMILES | CCCOCCOCCOC1OC(COC(=O)c2ccccc2)C(C)C(C)C1C |
| InChI | InChI=1S/C23H36O6/c1-5-11-25-12-13-26-14-15-27-23-19(4)17(2)18(3)21(29-23)16-28-22(24)20-9-7-6-8-10-20/h6-10,17-19,21,23H,5,11-16H2,1-4H3 |
| InChIKey | LZDDVHHSZVVKLO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|