C21H31F3O7SSi — CID 160624409
[(3R,4S,6R)-3,4-dimethyl-5-(trifluoromethylsulfonyloxy)-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl benzoate (PubChem CID 160624409) has the molecular formula C21H31F3O7SSi and a molecular weight of 512.62 g/mol. Its IUPAC name is [(3R,4S,6R)-3,4-dimethyl-5-(trifluoromethylsulfonyloxy)-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl benzoate.
| Compound Name | [(3R,4S,6R)-3,4-dimethyl-5-(trifluoromethylsulfonyloxy)-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 160624409 |
| Molecular Formula | C21H31F3O7SSi |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | [(3R,4S,6R)-3,4-dimethyl-5-(trifluoromethylsulfonyloxy)-6-(2-trimethylsilylethoxy)oxan-2-yl]methyl benzoate |
| SMILES | C[C@@H]1C(OS(=O)(=O)C(F)(F)F)[C@H](OCC[Si](C)(C)C)OC(COC(=O)c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C21H31F3O7SSi/c1-14-15(2)18(31-32(26,27)21(22,23)24)20(28-11-12-33(3,4)5)30-17(14)13-29-19(25)16-9-7-6-8-10-16/h6-10,14-15,17-18,20H,11-13H2,1-5H3/t14-,15+,17?,18?,20-/m1/s1 |
| InChIKey | WJQMEIBDNBMOML-HGXWWNEDSA-N |
| XLogP | 4.43 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|