C31H36Cl3O7P — CID 100986177
diethyl [(3S,4R,5R,6S)-3,4,5-tris[(4-chlorophenyl)methoxy]-6-methyloxan-2-yl] phosphite (PubChem CID 100986177) has the molecular formula C31H36Cl3O7P and a molecular weight of 657.96 g/mol. Its IUPAC name is diethyl [(3S,4R,5R,6S)-3,4,5-tris[(4-chlorophenyl)methoxy]-6-methyloxan-2-yl] phosphite.
| Compound Name | diethyl [(3S,4R,5R,6S)-3,4,5-tris[(4-chlorophenyl)methoxy]-6-methyloxan-2-yl] phosphite |
|---|---|
| PubChem CID | 100986177 |
| Molecular Formula | C31H36Cl3O7P |
| Molecular Weight | 657.96 g/mol |
| Exact Mass | 656.13 |
| IUPAC Name | diethyl [(3S,4R,5R,6S)-3,4,5-tris[(4-chlorophenyl)methoxy]-6-methyloxan-2-yl] phosphite |
| SMILES | CCOP(OCC)OC1O[C@@H](C)[C@@H](OCc2ccc(Cl)cc2)[C@@H](OCc2ccc(Cl)cc2)[C@@H]1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H36Cl3O7P/c1-4-38-42(39-5-2)41-31-30(37-20-24-10-16-27(34)17-11-24)29(36-19-23-8-14-26(33)15-9-23)28(21(3)40-31)35-18-22-6-12-25(32)13-7-22/h6-17,21,28-31H,4-5,18-20H2,1-3H3/t21-,28+,29+,30-,31?/m0/s1 |
| InChIKey | JCJLONTUQAPCLF-CYKLIRJKSA-N |
| XLogP | 8.76 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.96 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|