C30H30O5S — CID 102305405
[(2S,3R,4S,5R,6R)-3-ethynyl-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl acetate (PubChem CID 102305405) has the molecular formula C30H30O5S and a molecular weight of 502.63 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-3-ethynyl-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5R,6R)-3-ethynyl-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102305405 |
| Molecular Formula | C30H30O5S |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-3-ethynyl-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl acetate |
| SMILES | C#C[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](Sc2ccccc2)O[C@@H]1COC(C)=O |
| InChI | InChI=1S/C30H30O5S/c1-3-26-27(21-32-22(2)31)35-30(36-25-17-11-6-12-18-25)29(34-20-24-15-9-5-10-16-24)28(26)33-19-23-13-7-4-8-14-23/h1,4-18,26-30H,19-21H2,2H3/t26-,27-,28+,29-,30-/m1/s1 |
| InChIKey | VLVYJJMQNLWUOT-CMPUJJQDSA-N |
| XLogP | 5.49 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|