C54H48O8S — CID 23250965
2-O-[(4-phenylphenyl)methyl] 1-O-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl] benzene-1,2-dicarboxylate (PubChem CID 23250965) has the molecular formula C54H48O8S and a molecular weight of 857.04 g/mol. Its IUPAC name is 2-O-[(4-phenylphenyl)methyl] 1-O-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl] benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[(4-phenylphenyl)methyl] 1-O-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23250965 |
| Molecular Formula | C54H48O8S |
| Molecular Weight | 857.04 g/mol |
| Exact Mass | 856.31 |
| IUPAC Name | 2-O-[(4-phenylphenyl)methyl] 1-O-[[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl] benzene-1,2-dicarboxylate |
| SMILES | O=C(OCc1ccc(-c2ccccc2)cc1)c1ccccc1C(=O)OC[C@H]1O[C@H](Sc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C54H48O8S/c55-52(60-37-42-30-32-44(33-31-42)43-24-12-4-13-25-43)46-28-16-17-29-47(46)53(56)61-38-48-49(57-34-39-18-6-1-7-19-39)50(58-35-40-20-8-2-9-21-40)51(59-36-41-22-10-3-11-23-41)54(62-48)63-45-26-14-5-15-27-45/h1-33,48-51,54H,34-38H2/t48-,49-,50+,51-,54-/m1/s1 |
| InChIKey | DBZGRFZQUUPGBO-ZGOQYWAKSA-N |
| XLogP | 11.14 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.04 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |