C37H40O4S — CID 101009719
(2R,3S,4S,5S,6S)-5-(4-methylphenyl)sulfanyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-enyloxane (PubChem CID 101009719) has the molecular formula C37H40O4S and a molecular weight of 580.79 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-5-(4-methylphenyl)sulfanyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-enyloxane.
| Compound Name | (2R,3S,4S,5S,6S)-5-(4-methylphenyl)sulfanyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-enyloxane |
|---|---|
| PubChem CID | 101009719 |
| Molecular Formula | C37H40O4S |
| Molecular Weight | 580.79 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | (2R,3S,4S,5S,6S)-5-(4-methylphenyl)sulfanyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-6-prop-2-enyloxane |
| SMILES | C=CC[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C37H40O4S/c1-3-13-33-37(42-32-22-20-28(2)21-23-32)36(40-26-31-18-11-6-12-19-31)35(39-25-30-16-9-5-10-17-30)34(41-33)27-38-24-29-14-7-4-8-15-29/h3-12,14-23,33-37H,1,13,24-27H2,2H3/t33-,34+,35-,36-,37-/m0/s1 |
| InChIKey | OGUNBRBLIYVIJA-NCCXDUJKSA-N |
| XLogP | 8.19 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.79 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|