C39H41NO4S — CID 102270225
1-methyl-2-[(2S,3S,4S,5R,6R)-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pyrrole (PubChem CID 102270225) has the molecular formula C39H41NO4S and a molecular weight of 619.83 g/mol. Its IUPAC name is 1-methyl-2-[(2S,3S,4S,5R,6R)-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pyrrole.
| Compound Name | 1-methyl-2-[(2S,3S,4S,5R,6R)-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pyrrole |
|---|---|
| PubChem CID | 102270225 |
| Molecular Formula | C39H41NO4S |
| Molecular Weight | 619.83 g/mol |
| Exact Mass | 619.28 |
| IUPAC Name | 1-methyl-2-[(2S,3S,4S,5R,6R)-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pyrrole |
| SMILES | Cc1ccc(S[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)O[C@H]2c2cccn2C)cc1 |
| InChI | InChI=1S/C39H41NO4S/c1-29-20-22-33(23-21-29)45-39-36(34-19-12-24-40(34)2)44-35(28-41-25-30-13-6-3-7-14-30)37(42-26-31-15-8-4-9-16-31)38(39)43-27-32-17-10-5-11-18-32/h3-24,35-39H,25-28H2,1-2H3/t35-,36+,37-,38+,39+/m1/s1 |
| InChIKey | YDTAJQARPDUJLV-FGGCTIIKSA-N |
| XLogP | 8.32 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.83 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |