C43H46O5S — CID 102250616
(2S,3S,4S,5R,6R)-2-[(2R)-2-methoxy-2-phenylethyl]-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 102250616) has the molecular formula C43H46O5S and a molecular weight of 674.90 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-2-[(2R)-2-methoxy-2-phenylethyl]-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,3S,4S,5R,6R)-2-[(2R)-2-methoxy-2-phenylethyl]-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 102250616 |
| Molecular Formula | C43H46O5S |
| Molecular Weight | 674.90 g/mol |
| Exact Mass | 674.31 |
| IUPAC Name | (2S,3S,4S,5R,6R)-2-[(2R)-2-methoxy-2-phenylethyl]-3-(4-methylphenyl)sulfanyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | CO[C@H](C[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1Sc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C43H46O5S/c1-32-23-25-37(26-24-32)49-43-39(27-38(44-2)36-21-13-6-14-22-36)48-40(31-45-28-33-15-7-3-8-16-33)41(46-29-34-17-9-4-10-18-34)42(43)47-30-35-19-11-5-12-20-35/h3-26,38-43H,27-31H2,1-2H3/t38-,39+,40-,41-,42+,43+/m1/s1 |
| InChIKey | ATMVWLQIIKAVEM-WBJZALLNSA-N |
| XLogP | 9.39 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.90 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |