C44H48O6S — CID 10556692
(2S,3R,4S,5R,6R)-2-[(2S)-2-ethoxy-2-phenylethyl]sulfanyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 10556692) has the molecular formula C44H48O6S and a molecular weight of 704.93 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[(2S)-2-ethoxy-2-phenylethyl]sulfanyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,3R,4S,5R,6R)-2-[(2S)-2-ethoxy-2-phenylethyl]sulfanyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 10556692 |
| Molecular Formula | C44H48O6S |
| Molecular Weight | 704.93 g/mol |
| Exact Mass | 704.32 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[(2S)-2-ethoxy-2-phenylethyl]sulfanyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | CCO[C@H](CS[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H48O6S/c1-2-46-40(38-26-16-7-17-27-38)33-51-44-43(49-31-37-24-14-6-15-25-37)42(48-30-36-22-12-5-13-23-36)41(47-29-35-20-10-4-11-21-35)39(50-44)32-45-28-34-18-8-3-9-19-34/h3-27,39-44H,2,28-33H2,1H3/t39-,40-,41-,42+,43-,44+/m1/s1 |
| InChIKey | BIRKUYORAABGNX-AWRDEAFQSA-N |
| XLogP | 9.20 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.93 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |