C32H32O5S — CID 11203329
(2S,3R,4S,5S,6R)-2-(4-methylphenyl)sulfanyl-6-(trityloxymethyl)oxane-3,4,5-triol (PubChem CID 11203329) has the molecular formula C32H32O5S and a molecular weight of 528.67 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-(4-methylphenyl)sulfanyl-6-(trityloxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-(4-methylphenyl)sulfanyl-6-(trityloxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11203329 |
| Molecular Formula | C32H32O5S |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-(4-methylphenyl)sulfanyl-6-(trityloxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1ccc(S[C@@H]2O[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C32H32O5S/c1-22-17-19-26(20-18-22)38-31-30(35)29(34)28(33)27(37-31)21-36-32(23-11-5-2-6-12-23,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20,27-31,33-35H,21H2,1H3/t27-,28-,29+,30-,31+/m1/s1 |
| InChIKey | SZEXNRYBOGDTFD-SAEUYMBFSA-N |
| XLogP | 4.90 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|