C32H32O4S — CID 101261442
(2S,3R,4S,5R)-2-methoxy-4-(4-methylphenyl)sulfanyl-5-(trityloxymethyl)oxolan-3-ol (PubChem CID 101261442) has the molecular formula C32H32O4S and a molecular weight of 512.67 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-methoxy-4-(4-methylphenyl)sulfanyl-5-(trityloxymethyl)oxolan-3-ol.
| Compound Name | (2S,3R,4S,5R)-2-methoxy-4-(4-methylphenyl)sulfanyl-5-(trityloxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 101261442 |
| Molecular Formula | C32H32O4S |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | (2S,3R,4S,5R)-2-methoxy-4-(4-methylphenyl)sulfanyl-5-(trityloxymethyl)oxolan-3-ol |
| SMILES | CO[C@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](Sc2ccc(C)cc2)[C@@H]1O |
| InChI | InChI=1S/C32H32O4S/c1-23-18-20-27(21-19-23)37-30-28(36-31(34-2)29(30)33)22-35-32(24-12-6-3-7-13-24,25-14-8-4-9-15-25)26-16-10-5-11-17-26/h3-21,28-31,33H,22H2,1-2H3/t28-,29+,30-,31+/m1/s1 |
| InChIKey | NNATXWZEKPLJAF-ITGKQZKFSA-N |
| XLogP | 6.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|