C20H21F3O4 — CID 67569911
(2S,4R,5R,6S)-4,5-bis(phenylmethoxy)-6-(trifluoromethyl)oxan-2-ol (PubChem CID 67569911) has the molecular formula C20H21F3O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is (2S,4R,5R,6S)-4,5-bis(phenylmethoxy)-6-(trifluoromethyl)oxan-2-ol.
| Compound Name | (2S,4R,5R,6S)-4,5-bis(phenylmethoxy)-6-(trifluoromethyl)oxan-2-ol |
|---|---|
| PubChem CID | 67569911 |
| Molecular Formula | C20H21F3O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (2S,4R,5R,6S)-4,5-bis(phenylmethoxy)-6-(trifluoromethyl)oxan-2-ol |
| SMILES | O[C@@H]1C[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](C(F)(F)F)O1 |
| InChI | InChI=1S/C20H21F3O4/c21-20(22,23)19-18(26-13-15-9-5-2-6-10-15)16(11-17(24)27-19)25-12-14-7-3-1-4-8-14/h1-10,16-19,24H,11-13H2/t16-,17+,18-,19+/m1/s1 |
| InChIKey | FSNUYFLNBAKQHH-HCXYKTFWSA-N |
| XLogP | 3.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |