C34H38O9 — CID 146628802
[(2R,3R,4S,5R)-6-hydroxy-4,5-di(propanoyloxy)-2-(trityloxymethyl)oxan-3-yl] propanoate (PubChem CID 146628802) has the molecular formula C34H38O9 and a molecular weight of 590.67 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-6-hydroxy-4,5-di(propanoyloxy)-2-(trityloxymethyl)oxan-3-yl] propanoate.
| Compound Name | [(2R,3R,4S,5R)-6-hydroxy-4,5-di(propanoyloxy)-2-(trityloxymethyl)oxan-3-yl] propanoate |
|---|---|
| PubChem CID | 146628802 |
| Molecular Formula | C34H38O9 |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | [(2R,3R,4S,5R)-6-hydroxy-4,5-di(propanoyloxy)-2-(trityloxymethyl)oxan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H](OC(=O)CC)[C@@H](OC(=O)CC)C(O)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H38O9/c1-4-27(35)41-30-26(40-33(38)32(43-29(37)6-3)31(30)42-28(36)5-2)22-39-34(23-16-10-7-11-17-23,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-21,26,30-33,38H,4-6,22H2,1-3H3/t26-,30-,31+,32-,33?/m1/s1 |
| InChIKey | NAZPJNYKEWRGGJ-NLKOSQCUSA-N |
| XLogP | 4.68 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|