C46H54O9S — CID 11814727
[(2R,3R,4S,5R,6S)-6-(benzenesulfinyl)-4,5-bis(2,2-dimethylpropanoyloxy)-2-(trityloxymethyl)oxan-3-yl] 2,2-dimethylpropanoate (PubChem CID 11814727) has the molecular formula C46H54O9S and a molecular weight of 783.00 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-(benzenesulfinyl)-4,5-bis(2,2-dimethylpropanoyloxy)-2-(trityloxymethyl)oxan-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-(benzenesulfinyl)-4,5-bis(2,2-dimethylpropanoyloxy)-2-(trityloxymethyl)oxan-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11814727 |
| Molecular Formula | C46H54O9S |
| Molecular Weight | 783.00 g/mol |
| Exact Mass | 782.35 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-(benzenesulfinyl)-4,5-bis(2,2-dimethylpropanoyloxy)-2-(trityloxymethyl)oxan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@@H]1[C@@H](OC(=O)C(C)(C)C)[C@H](S(=O)c2ccccc2)O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C46H54O9S/c1-43(2,3)40(47)53-36-35(30-51-46(31-22-14-10-15-23-31,32-24-16-11-17-25-32)33-26-18-12-19-27-33)52-39(56(50)34-28-20-13-21-29-34)38(55-42(49)45(7,8)9)37(36)54-41(48)44(4,5)6/h10-29,35-39H,30H2,1-9H3/t35-,36-,37+,38-,39+,56?/m1/s1 |
| InChIKey | ZWMHKTGAPUASEU-ALOMDHNASA-N |
| XLogP | 8.40 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.00 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|