C29H32O8 — CID 146231174
4-[3,4,5-trihydroxy-6-(trityloxymethyl)oxan-2-yl]oxybutanoic acid (PubChem CID 146231174) has the molecular formula C29H32O8 and a molecular weight of 508.57 g/mol. Its IUPAC name is 4-[3,4,5-trihydroxy-6-(trityloxymethyl)oxan-2-yl]oxybutanoic acid.
| Compound Name | 4-[3,4,5-trihydroxy-6-(trityloxymethyl)oxan-2-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 146231174 |
| Molecular Formula | C29H32O8 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 4-[3,4,5-trihydroxy-6-(trityloxymethyl)oxan-2-yl]oxybutanoic acid |
| SMILES | O=C(O)CCCOC1OC(COC(c2ccccc2)(c2ccccc2)c2ccccc2)C(O)C(O)C1O |
| InChI | InChI=1S/C29H32O8/c30-24(31)17-10-18-35-28-27(34)26(33)25(32)23(37-28)19-36-29(20-11-4-1-5-12-20,21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-9,11-16,23,25-28,32-34H,10,17-19H2,(H,30,31) |
| InChIKey | AXMLGGAPRKFLEG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|