C15H15NO6 — CID 122482230
4-O-benzyl 1-O-[(2-oxo-1,3-oxazolidin-5-yl)methyl] (E)-but-2-enedioate (PubChem CID 122482230) has the molecular formula C15H15NO6 and a molecular weight of 305.29 g/mol. Its IUPAC name is 4-O-benzyl 1-O-[(2-oxo-1,3-oxazolidin-5-yl)methyl] (E)-but-2-enedioate.
| Compound Name | 4-O-benzyl 1-O-[(2-oxo-1,3-oxazolidin-5-yl)methyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122482230 |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-O-benzyl 1-O-[(2-oxo-1,3-oxazolidin-5-yl)methyl] (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)OCC1CNC(=O)O1)OCc1ccccc1 |
| InChI | InChI=1S/C15H15NO6/c17-13(20-9-11-4-2-1-3-5-11)6-7-14(18)21-10-12-8-16-15(19)22-12/h1-7,12H,8-10H2,(H,16,19)/b7-6+ |
| InChIKey | TZNVPKIPBBLTFW-VOTSOKGWSA-N |
| XLogP | 0.94 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|