C16H14N2O6 — CID 122466930
1-O-benzyl 4-O-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl] (E)-but-2-enedioate (PubChem CID 122466930) has the molecular formula C16H14N2O6 and a molecular weight of 330.30 g/mol. Its IUPAC name is 1-O-benzyl 4-O-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl] (E)-but-2-enedioate.
| Compound Name | 1-O-benzyl 4-O-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122466930 |
| Molecular Formula | C16H14N2O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 1-O-benzyl 4-O-[(2,4-dioxo-1H-pyrimidin-6-yl)methyl] (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)OCc1cc(=O)[nH]c(=O)[nH]1)OCc1ccccc1 |
| InChI | InChI=1S/C16H14N2O6/c19-13-8-12(17-16(22)18-13)10-24-15(21)7-6-14(20)23-9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H2,17,18,19,22)/b7-6+ |
| InChIKey | NLXJVQLJCMSZSF-VOTSOKGWSA-N |
| XLogP | 0.41 |
| TPSA | 118.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|