C12H17N3 — CID 84777497
3-(3,6-diazabicyclo[3.1.1]heptan-3-ylmethyl)aniline (PubChem CID 84777497) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 3-(3,6-diazabicyclo[3.1.1]heptan-3-ylmethyl)aniline.
| Compound Name | 3-(3,6-diazabicyclo[3.1.1]heptan-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 84777497 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 3-(3,6-diazabicyclo[3.1.1]heptan-3-ylmethyl)aniline |
| SMILES | Nc1cccc(CN2CC3CC(C2)N3)c1 |
| InChI | InChI=1S/C12H17N3/c13-10-3-1-2-9(4-10)6-15-7-11-5-12(8-15)14-11/h1-4,11-12,14H,5-8,13H2 |
| InChIKey | IJJDBFUGMRYNHT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|