C15H19BrN4 — CID 10520770
(1S,5S)-2-azido-9-benzyl-6-bromo-9-azabicyclo[3.3.1]nonane (PubChem CID 10520770) has the molecular formula C15H19BrN4 and a molecular weight of 335.25 g/mol. Its IUPAC name is (1S,5S)-2-azido-9-benzyl-6-bromo-9-azabicyclo[3.3.1]nonane.
| Compound Name | (1S,5S)-2-azido-9-benzyl-6-bromo-9-azabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 10520770 |
| Molecular Formula | C15H19BrN4 |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (1S,5S)-2-azido-9-benzyl-6-bromo-9-azabicyclo[3.3.1]nonane |
| SMILES | [N-]=[N+]=NC1CC[C@H]2C(Br)CC[C@@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C15H19BrN4/c16-12-6-8-15-13(18-19-17)7-9-14(12)20(15)10-11-4-2-1-3-5-11/h1-5,12-15H,6-10H2/t12?,13?,14-,15-/m0/s1 |
| InChIKey | AFZGYSNJNHEFDE-WUCCLRPBSA-N |
| XLogP | 4.26 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|