About azidomethylbenzene;9-benzyl-9-azabicyclo[6.1.0]nonane;cyclooctene
azidomethylbenzene;9-benzyl-9-azabicyclo[6.1.0]nonane;cyclooctene (PubChem CID 158872067) has the molecular formula C30H42N4
and a molecular weight of 458.69 g/mol. Its IUPAC name is azidomethylbenzene;9-benzyl-9-azabicyclo[6.1.0]nonane;cyclooctene.
Molecular Properties
| Compound Name | azidomethylbenzene;9-benzyl-9-azabicyclo[6.1.0]nonane;cyclooctene |
| PubChem CID | 158872067 |
| Molecular Formula | C30H42N4 |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | azidomethylbenzene;9-benzyl-9-azabicyclo[6.1.0]nonane;cyclooctene |
| SMILES | C1=CCCCCCC1.[N-]=[N+]=NCc1ccccc1.c1ccc(CN2C3CCCCCCC32)cc1 |
| InChI | InChI=1S/C15H21N.C8H14.C7H7N3/c1-2-7-11-15-14(10-6-1)16(15)12-13-8-4-3-5-9-13;1-2-4-6-8-7-5-3-1;8-10-9-6-7-4-2-1-3-5-7/h3-5,8-9,14-15H,1-2,6-7,10-12H2;1-2H,3-8H2;1-5H,6H2 |
| InChIKey | JBYVEGGOHJXWKB-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azidomethylbenzene;9-benzyl-9-azabicyclo[6.1.0]nonane;cyclooctene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azidomethylbenzene;9-benzyl-9-azabicyclo[6.1.0]nonane;cyclooctene?
The IUPAC name of azidomethylbenzene;9-benzyl-9-azabicyclo[6.1.0]nonane;cyclooctene (CID 158872067) is azidomethylbenzene;9-benzyl-9-azabicyclo[6.1.0]nonane;cyclooctene.
What is the SMILES notation for azidomethylbenzene;9-benzyl-9-azabicyclo[6.1.0]nonane;cyclooctene?
The canonical SMILES for azidomethylbenzene;9-benzyl-9-azabicyclo[6.1.0]nonane;cyclooctene is C1=CCCCCCC1.[N-]=[N+]=NCc1ccccc1.c1ccc(CN2C3CCCCCCC32)cc1.
What is the InChIKey of azidomethylbenzene;9-benzyl-9-azabicyclo[6.1.0]nonane;cyclooctene?
The InChIKey is JBYVEGGOHJXWKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N.C8H14.C7H7N3/c1-2-7-11-15-14(10-6-1)16(15)12-13-8-4-3-5-9-13;1-2-4-6-8-7-5-3-1;8-10-9-6-7-4-2-1-3-5-7/h3-5,8-9,14-15H,1-2,6-7,10-12H2;1-2H,3-8H2;1-5H,6H2.
What are the key properties of azidomethylbenzene;9-benzyl-9-azabicyclo[6.1.0]nonane;cyclooctene?
azidomethylbenzene;9-benzyl-9-azabicyclo[6.1.0]nonane;cyclooctene has a molecular weight of 458.69 g/mol, XLogP of 8.99, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azidomethylbenzene;9-benzyl-9-azabicyclo[6.1.0]nonane;cyclooctene is sourced from PubChem (CID 158872067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).