C21H23ClN2O2 — CID 10690569
ethyl (1S,2R,3R,4R)-7-benzyl-3-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 10690569) has the molecular formula C21H23ClN2O2 and a molecular weight of 370.88 g/mol. Its IUPAC name is ethyl (1S,2R,3R,4R)-7-benzyl-3-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | ethyl (1S,2R,3R,4R)-7-benzyl-3-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 10690569 |
| Molecular Formula | C21H23ClN2O2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | ethyl (1S,2R,3R,4R)-7-benzyl-3-(6-chloro-3-pyridinyl)-7-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](c2ccc(Cl)nc2)[C@H]2CC[C@@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C21H23ClN2O2/c1-2-26-21(25)20-17-10-9-16(19(20)15-8-11-18(22)23-12-15)24(17)13-14-6-4-3-5-7-14/h3-8,11-12,16-17,19-20H,2,9-10,13H2,1H3/t16-,17+,19-,20+/m1/s1 |
| InChIKey | DNFSZTJVYGVXMT-BWPNAZKDSA-N |
| XLogP | 4.04 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|