C19H22ClN3O2 — CID 175598908
ethyl 1-benzyl-4-(5-chloropyrazin-2-yl)piperidine-3-carboxylate (PubChem CID 175598908) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is ethyl 1-benzyl-4-(5-chloropyrazin-2-yl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-benzyl-4-(5-chloropyrazin-2-yl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 175598908 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | ethyl 1-benzyl-4-(5-chloropyrazin-2-yl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CN(Cc2ccccc2)CCC1c1cnc(Cl)cn1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-2-25-19(24)16-13-23(12-14-6-4-3-5-7-14)9-8-15(16)17-10-22-18(20)11-21-17/h3-7,10-11,15-16H,2,8-9,12-13H2,1H3 |
| InChIKey | QMMHIVXCYUNLAY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |