C21H29N3OS — CID 146541535
3-(benzylamino)-4-(cyclohexylamino)-N-ethylbenzenesulfinamide (PubChem CID 146541535) has the molecular formula C21H29N3OS and a molecular weight of 371.55 g/mol. Its IUPAC name is 3-(benzylamino)-4-(cyclohexylamino)-N-ethylbenzenesulfinamide.
| Compound Name | 3-(benzylamino)-4-(cyclohexylamino)-N-ethylbenzenesulfinamide |
|---|---|
| PubChem CID | 146541535 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 3-(benzylamino)-4-(cyclohexylamino)-N-ethylbenzenesulfinamide |
| SMILES | CCNS(=O)c1ccc(NC2CCCCC2)c(NCc2ccccc2)c1 |
| InChI | InChI=1S/C21H29N3OS/c1-2-23-26(25)19-13-14-20(24-18-11-7-4-8-12-18)21(15-19)22-16-17-9-5-3-6-10-17/h3,5-6,9-10,13-15,18,22-24H,2,4,7-8,11-12,16H2,1H3 |
| InChIKey | KMHBPBQMABPOEW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |