C28H30N2O4 — CID 22660798
methyl 4-(cyclohexylamino)-3-[(4-phenylmethoxybenzoyl)amino]benzoate (PubChem CID 22660798) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is methyl 4-(cyclohexylamino)-3-[(4-phenylmethoxybenzoyl)amino]benzoate.
| Compound Name | methyl 4-(cyclohexylamino)-3-[(4-phenylmethoxybenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 22660798 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | methyl 4-(cyclohexylamino)-3-[(4-phenylmethoxybenzoyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC2CCCCC2)c(NC(=O)c2ccc(OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C28H30N2O4/c1-33-28(32)22-14-17-25(29-23-10-6-3-7-11-23)26(18-22)30-27(31)21-12-15-24(16-13-21)34-19-20-8-4-2-5-9-20/h2,4-5,8-9,12-18,23,29H,3,6-7,10-11,19H2,1H3,(H,30,31) |
| InChIKey | FGMQUYBZRDJDPM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |