C27H27N3O2S — CID 101144444
methyl 1-(benzylcarbamothioyl)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-8-carboxylate (PubChem CID 101144444) has the molecular formula C27H27N3O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is methyl 1-(benzylcarbamothioyl)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-8-carboxylate.
| Compound Name | methyl 1-(benzylcarbamothioyl)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 101144444 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | methyl 1-(benzylcarbamothioyl)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C1C(CCN1C(=S)NCc1ccccc1)C(c1ccccc1)N2 |
| InChI | InChI=1S/C27H27N3O2S/c1-32-26(31)20-12-13-23-22(16-20)25-21(24(29-23)19-10-6-3-7-11-19)14-15-30(25)27(33)28-17-18-8-4-2-5-9-18/h2-13,16,21,24-25,29H,14-15,17H2,1H3,(H,28,33) |
| InChIKey | MDWFINBOCLLJIL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|