C26H26N2O2 — CID 54666187
1-[(3aS,4R,9bS)-4-(hydroxymethyl)-8-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-2-phenylethanone (PubChem CID 54666187) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is 1-[(3aS,4R,9bS)-4-(hydroxymethyl)-8-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-2-phenylethanone.
| Compound Name | 1-[(3aS,4R,9bS)-4-(hydroxymethyl)-8-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 54666187 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-[(3aS,4R,9bS)-4-(hydroxymethyl)-8-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1CC[C@H]2[C@H](CO)Nc3ccc(-c4ccccc4)cc3[C@H]21 |
| InChI | InChI=1S/C26H26N2O2/c29-17-24-21-13-14-28(25(30)15-18-7-3-1-4-8-18)26(21)22-16-20(11-12-23(22)27-24)19-9-5-2-6-10-19/h1-12,16,21,24,26-27,29H,13-15,17H2/t21-,24-,26-/m0/s1 |
| InChIKey | HPLLNSLMMJDLCP-CVJWPJSTSA-N |
| XLogP | 4.27 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |