C23H22N4O2 — CID 54665562
[(3aS,4S,9bS)-4-(hydroxymethyl)-8-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-pyrazin-2-ylmethanone (PubChem CID 54665562) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is [(3aS,4S,9bS)-4-(hydroxymethyl)-8-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(3aS,4S,9bS)-4-(hydroxymethyl)-8-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 54665562 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [(3aS,4S,9bS)-4-(hydroxymethyl)-8-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1CC[C@@H]2[C@H]1c1cc(-c3ccccc3)ccc1N[C@@H]2CO |
| InChI | InChI=1S/C23H22N4O2/c28-14-21-17-8-11-27(23(29)20-13-24-9-10-25-20)22(17)18-12-16(6-7-19(18)26-21)15-4-2-1-3-5-15/h1-7,9-10,12-13,17,21-22,26,28H,8,11,14H2/t17-,21+,22-/m0/s1 |
| InChIKey | ZAROACMCMGCNBC-WTOYTKOKSA-N |
| XLogP | 3.13 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |