C24H23FN4O2 — CID 134829710
[(3aR,4R,9bS)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-pyrazin-2-ylmethanone (PubChem CID 134829710) has the molecular formula C24H23FN4O2 and a molecular weight of 418.47 g/mol. Its IUPAC name is [(3aR,4R,9bS)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(3aR,4R,9bS)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 134829710 |
| Molecular Formula | C24H23FN4O2 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | [(3aR,4R,9bS)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-pyrazin-2-ylmethanone |
| SMILES | CN1c2ccc(-c3cccc(F)c3)cc2[C@@H]2[C@@H](CCN2C(=O)c2cnccn2)[C@@H]1CO |
| InChI | InChI=1S/C24H23FN4O2/c1-28-21-6-5-16(15-3-2-4-17(25)11-15)12-19(21)23-18(22(28)14-30)7-10-29(23)24(31)20-13-26-8-9-27-20/h2-6,8-9,11-13,18,22-23,30H,7,10,14H2,1H3/t18-,22-,23-/m0/s1 |
| InChIKey | KEUIPYNAVGFAPO-TZYHBYERSA-N |
| XLogP | 3.30 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |