C27H24FN3O2 — CID 134829827
[(3aS,4R,9bR)-4-(hydroxymethyl)-5-methyl-8-(2-pyridin-3-ylethynyl)-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-(3-fluorophenyl)methanone (PubChem CID 134829827) has the molecular formula C27H24FN3O2 and a molecular weight of 441.51 g/mol. Its IUPAC name is [(3aS,4R,9bR)-4-(hydroxymethyl)-5-methyl-8-(2-pyridin-3-ylethynyl)-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-(3-fluorophenyl)methanone.
| Compound Name | [(3aS,4R,9bR)-4-(hydroxymethyl)-5-methyl-8-(2-pyridin-3-ylethynyl)-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 134829827 |
| Molecular Formula | C27H24FN3O2 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | [(3aS,4R,9bR)-4-(hydroxymethyl)-5-methyl-8-(2-pyridin-3-ylethynyl)-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-(3-fluorophenyl)methanone |
| SMILES | CN1c2ccc(C#Cc3cccnc3)cc2[C@H]2[C@H](CCN2C(=O)c2cccc(F)c2)[C@@H]1CO |
| InChI | InChI=1S/C27H24FN3O2/c1-30-24-10-9-18(7-8-19-4-3-12-29-16-19)14-23(24)26-22(25(30)17-32)11-13-31(26)27(33)20-5-2-6-21(28)15-20/h2-6,9-10,12,14-16,22,25-26,32H,11,13,17H2,1H3/t22-,25+,26-/m1/s1 |
| InChIKey | TVGDYLSRILWCFN-ZSQFBXSQSA-N |
| XLogP | 3.63 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|