C27H25FN2O4 — CID 54665546
[(3aS,4S,9bR)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-(1,3-benzodioxol-5-yl)methanone (PubChem CID 54665546) has the molecular formula C27H25FN2O4 and a molecular weight of 460.51 g/mol. Its IUPAC name is [(3aS,4S,9bR)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-(1,3-benzodioxol-5-yl)methanone.
| Compound Name | [(3aS,4S,9bR)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-(1,3-benzodioxol-5-yl)methanone |
|---|---|
| PubChem CID | 54665546 |
| Molecular Formula | C27H25FN2O4 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | [(3aS,4S,9bR)-8-(3-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-(1,3-benzodioxol-5-yl)methanone |
| SMILES | CN1c2ccc(-c3cccc(F)c3)cc2[C@H]2[C@H](CCN2C(=O)c2ccc3c(c2)OCO3)[C@H]1CO |
| InChI | InChI=1S/C27H25FN2O4/c1-29-22-7-5-17(16-3-2-4-19(28)11-16)12-21(22)26-20(23(29)14-31)9-10-30(26)27(32)18-6-8-24-25(13-18)34-15-33-24/h2-8,11-13,20,23,26,31H,9-10,14-15H2,1H3/t20-,23-,26-/m1/s1 |
| InChIKey | GRGSXQJASNVNJF-ROSOWXQZSA-N |
| XLogP | 4.24 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |