C29H29N3O5 — CID 54665229
3-[(3aS,4S,9bS)-1-(1,3-benzodioxole-5-carbonyl)-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-8-yl]-N,N-dimethylbenzamide (PubChem CID 54665229) has the molecular formula C29H29N3O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is 3-[(3aS,4S,9bS)-1-(1,3-benzodioxole-5-carbonyl)-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-8-yl]-N,N-dimethylbenzamide.
| Compound Name | 3-[(3aS,4S,9bS)-1-(1,3-benzodioxole-5-carbonyl)-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-8-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 54665229 |
| Molecular Formula | C29H29N3O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 3-[(3aS,4S,9bS)-1-(1,3-benzodioxole-5-carbonyl)-4-(hydroxymethyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-8-yl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(-c2ccc3c(c2)[C@@H]2[C@@H](CCN2C(=O)c2ccc4c(c2)OCO4)[C@@H](CO)N3)c1 |
| InChI | InChI=1S/C29H29N3O5/c1-31(2)28(34)19-5-3-4-17(12-19)18-6-8-23-22(13-18)27-21(24(15-33)30-23)10-11-32(27)29(35)20-7-9-25-26(14-20)37-16-36-25/h3-9,12-14,21,24,27,30,33H,10-11,15-16H2,1-2H3/t21-,24+,27-/m0/s1 |
| InChIKey | SGBKWQAGQMGIJJ-WBWMCNGVSA-N |
| XLogP | 3.77 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |