C28H24N2O4 — CID 54665221
[(3aR,4S,9bR)-4-(hydroxymethyl)-8-(2-phenylethynyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-(1,3-benzodioxol-5-yl)methanone (PubChem CID 54665221) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is [(3aR,4S,9bR)-4-(hydroxymethyl)-8-(2-phenylethynyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-(1,3-benzodioxol-5-yl)methanone.
| Compound Name | [(3aR,4S,9bR)-4-(hydroxymethyl)-8-(2-phenylethynyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-(1,3-benzodioxol-5-yl)methanone |
|---|---|
| PubChem CID | 54665221 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | [(3aR,4S,9bR)-4-(hydroxymethyl)-8-(2-phenylethynyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-1-yl]-(1,3-benzodioxol-5-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)N1CC[C@@H]2[C@@H](CO)Nc3ccc(C#Cc4ccccc4)cc3[C@@H]21 |
| InChI | InChI=1S/C28H24N2O4/c31-16-24-21-12-13-30(28(32)20-9-11-25-26(15-20)34-17-33-25)27(21)22-14-19(8-10-23(22)29-24)7-6-18-4-2-1-3-5-18/h1-5,8-11,14-15,21,24,27,29,31H,12-13,16-17H2/t21-,24-,27-/m1/s1 |
| InChIKey | YBDZRUHFJSYPOP-GNMGOMLTSA-N |
| XLogP | 3.80 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|