C27H25FN2O3S — CID 134829629
[(3aS,4R,9bS)-8-[2-(2-fluorophenyl)ethynyl]-1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol (PubChem CID 134829629) has the molecular formula C27H25FN2O3S and a molecular weight of 476.57 g/mol. Its IUPAC name is [(3aS,4R,9bS)-8-[2-(2-fluorophenyl)ethynyl]-1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol.
| Compound Name | [(3aS,4R,9bS)-8-[2-(2-fluorophenyl)ethynyl]-1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 134829629 |
| Molecular Formula | C27H25FN2O3S |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | [(3aS,4R,9bS)-8-[2-(2-fluorophenyl)ethynyl]-1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@H]3[C@H](CO)Nc4ccc(C#Cc5ccccc5F)cc4[C@H]32)cc1 |
| InChI | InChI=1S/C27H25FN2O3S/c1-18-6-11-21(12-7-18)34(32,33)30-15-14-22-26(17-31)29-25-13-9-19(16-23(25)27(22)30)8-10-20-4-2-3-5-24(20)28/h2-7,9,11-13,16,22,26-27,29,31H,14-15,17H2,1H3/t22-,26-,27-/m0/s1 |
| InChIKey | SRUSNRKSCOSNPD-CAVYSCNFSA-N |
| XLogP | 4.07 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|