C28H28N2O4S — CID 54665938
[(3aR,4R,9bR)-8-[2-(4-methoxyphenyl)ethynyl]-1-(2-methylphenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol (PubChem CID 54665938) has the molecular formula C28H28N2O4S and a molecular weight of 488.61 g/mol. Its IUPAC name is [(3aR,4R,9bR)-8-[2-(4-methoxyphenyl)ethynyl]-1-(2-methylphenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol.
| Compound Name | [(3aR,4R,9bR)-8-[2-(4-methoxyphenyl)ethynyl]-1-(2-methylphenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 54665938 |
| Molecular Formula | C28H28N2O4S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [(3aR,4R,9bR)-8-[2-(4-methoxyphenyl)ethynyl]-1-(2-methylphenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
| SMILES | COc1ccc(C#Cc2ccc3c(c2)[C@H]2[C@H](CCN2S(=O)(=O)c2ccccc2C)[C@H](CO)N3)cc1 |
| InChI | InChI=1S/C28H28N2O4S/c1-19-5-3-4-6-27(19)35(32,33)30-16-15-23-26(18-31)29-25-14-11-21(17-24(25)28(23)30)8-7-20-9-12-22(34-2)13-10-20/h3-6,9-14,17,23,26,28-29,31H,15-16,18H2,1-2H3/t23-,26+,28-/m1/s1 |
| InChIKey | VYQURDXXTCLBOR-RXWNPYQGSA-N |
| XLogP | 3.94 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|