C25H26N2O4S — CID 54666156
[(3aS,4S,9bS)-1-(2-methoxyphenyl)sulfonyl-8-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol (PubChem CID 54666156) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is [(3aS,4S,9bS)-1-(2-methoxyphenyl)sulfonyl-8-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol.
| Compound Name | [(3aS,4S,9bS)-1-(2-methoxyphenyl)sulfonyl-8-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 54666156 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [(3aS,4S,9bS)-1-(2-methoxyphenyl)sulfonyl-8-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
| SMILES | COc1ccccc1S(=O)(=O)N1CC[C@@H]2[C@H]1c1cc(-c3ccccc3)ccc1N[C@@H]2CO |
| InChI | InChI=1S/C25H26N2O4S/c1-31-23-9-5-6-10-24(23)32(29,30)27-14-13-19-22(16-28)26-21-12-11-18(15-20(21)25(19)27)17-7-3-2-4-8-17/h2-12,15,19,22,25-26,28H,13-14,16H2,1H3/t19-,22+,25-/m0/s1 |
| InChIKey | KNDPZKMYOYQCGD-SWHJIRTISA-N |
| XLogP | 3.90 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |