C26H25N3O4S — CID 54665521
[(3aS,4S,9bS)-1-(4-methoxyphenyl)sulfonyl-8-(2-pyridin-3-ylethynyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol (PubChem CID 54665521) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is [(3aS,4S,9bS)-1-(4-methoxyphenyl)sulfonyl-8-(2-pyridin-3-ylethynyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol.
| Compound Name | [(3aS,4S,9bS)-1-(4-methoxyphenyl)sulfonyl-8-(2-pyridin-3-ylethynyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 54665521 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | [(3aS,4S,9bS)-1-(4-methoxyphenyl)sulfonyl-8-(2-pyridin-3-ylethynyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
| SMILES | COc1ccc(S(=O)(=O)N2CC[C@@H]3[C@H]2c2cc(C#Cc4cccnc4)ccc2N[C@@H]3CO)cc1 |
| InChI | InChI=1S/C26H25N3O4S/c1-33-20-7-9-21(10-8-20)34(31,32)29-14-12-22-25(17-30)28-24-11-6-18(15-23(24)26(22)29)4-5-19-3-2-13-27-16-19/h2-3,6-11,13,15-16,22,25-26,28,30H,12,14,17H2,1H3/t22-,25+,26-/m0/s1 |
| InChIKey | OYJZICUUUYKHTJ-DFCKQENNSA-N |
| XLogP | 3.03 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|