C26H25N3O4S — CID 54665246
4-[(3aR,4S,9bR)-4-(hydroxymethyl)-1-(3-methoxyphenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-8-yl]benzonitrile (PubChem CID 54665246) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is 4-[(3aR,4S,9bR)-4-(hydroxymethyl)-1-(3-methoxyphenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-8-yl]benzonitrile.
| Compound Name | 4-[(3aR,4S,9bR)-4-(hydroxymethyl)-1-(3-methoxyphenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-8-yl]benzonitrile |
|---|---|
| PubChem CID | 54665246 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 4-[(3aR,4S,9bR)-4-(hydroxymethyl)-1-(3-methoxyphenyl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-8-yl]benzonitrile |
| SMILES | COc1cccc(S(=O)(=O)N2CC[C@@H]3[C@@H](CO)Nc4ccc(-c5ccc(C#N)cc5)cc4[C@@H]32)c1 |
| InChI | InChI=1S/C26H25N3O4S/c1-33-20-3-2-4-21(14-20)34(31,32)29-12-11-22-25(16-30)28-24-10-9-19(13-23(24)26(22)29)18-7-5-17(15-27)6-8-18/h2-10,13-14,22,25-26,28,30H,11-12,16H2,1H3/t22-,25-,26-/m1/s1 |
| InChIKey | XUASMCDFJGQWOT-DNRSQYFGSA-N |
| XLogP | 3.77 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |