C24H23FN4O3S — CID 54666316
[(3aR,4R,9bR)-8-[2-(4-fluorophenyl)ethynyl]-1-(1-methylimidazol-4-yl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol (PubChem CID 54666316) has the molecular formula C24H23FN4O3S and a molecular weight of 466.54 g/mol. Its IUPAC name is [(3aR,4R,9bR)-8-[2-(4-fluorophenyl)ethynyl]-1-(1-methylimidazol-4-yl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol.
| Compound Name | [(3aR,4R,9bR)-8-[2-(4-fluorophenyl)ethynyl]-1-(1-methylimidazol-4-yl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 54666316 |
| Molecular Formula | C24H23FN4O3S |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | [(3aR,4R,9bR)-8-[2-(4-fluorophenyl)ethynyl]-1-(1-methylimidazol-4-yl)sulfonyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinolin-4-yl]methanol |
| SMILES | Cn1cnc(S(=O)(=O)N2CC[C@@H]3[C@H](CO)Nc4ccc(C#Cc5ccc(F)cc5)cc4[C@@H]32)c1 |
| InChI | InChI=1S/C24H23FN4O3S/c1-28-13-23(26-15-28)33(31,32)29-11-10-19-22(14-30)27-21-9-6-17(12-20(21)24(19)29)3-2-16-4-7-18(25)8-5-16/h4-9,12-13,15,19,22,24,27,30H,10-11,14H2,1H3/t19-,22+,24-/m1/s1 |
| InChIKey | WCEOOKHJDJOOJO-WNOPAQSVSA-N |
| XLogP | 2.50 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|